| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 12:11:13 UTC |
|---|
| Update Date | 2025-03-24 21:31:21 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID01804064 |
|---|
| Frequency | 0.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C35H61NO28 |
|---|
| Molecular Mass | 943.338 |
|---|
| SMILES | CC(=O)NC1C(O)CC(OCC2C(O)C(O)C(O)C(OC3C(CO)OC(OC4C(O)C(CO)OC(OC(C(O)CO)C(O)CO)C4O)OC3CO)C2O)(C(=O)O)OC1C(O)C(O)CO |
|---|
| InChI Key | UTRHDPFOIXPHKO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | c-glucuronides |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,3-dioxanesacetamidescarbonyl compoundscarboxylic acid orthoesterscarboxylic acidscyclitols and derivativescyclohexanolsdialkyl ethershydrocarbon derivativesketalsmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsortho estersoxacyclic compoundsoxanesprimary alcoholspyran carboxylic acidssecondary carboxylic acid amides |
|---|
| Substituents | carbonyl groupethercarboxylic acidortho estermonosaccharidecarboxylic acid orthoestercarboxylic acid derivativepyran carboxylic aciddialkyl etherorganic oxideacetalketalaliphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundorthocarboxylic acid derivativeoxaneprimary alcoholorganoheterocyclic compoundacetamidec-glucuronidealcoholpyran carboxylic acid or derivativescyclohexanolcyclitol or derivativescyclic alcoholcarboxamide groupoxacyclesecondary carboxylic acid amidemonocarboxylic acid or derivativespyransecondary alcoholhydrocarbon derivativeorganic nitrogen compoundmeta-dioxane |
|---|