| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 12:13:13 UTC |
|---|
| Update Date | 2025-03-24 21:32:15 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID01809021 |
|---|
| Frequency | 0.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C36H42O26 |
|---|
| Molecular Mass | 890.1964 |
|---|
| SMILES | O=C1CC(C2=CC(OC3OC(C(=O)O)C(O)C(O)C3O)=CC3=CC(O3)C(O)C(O)C(O)C(C(=O)O)O2)OC(C(O)CO)c2cc(OC3OC(C(=O)O)C(O)C(O)C3O)cc(O)c21 |
|---|
| InChI Key | SPWHBRBGZAJFMQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | o-glucuronides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsacetalsaryl alkyl ketonesbenzoxepinesbeta hydroxy acids and derivativescarboxylic acidsdialkyl ethersglucuronic acid derivativeshydrocarbon derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanesoxetenesphenol ethersprimary alcoholspyran carboxylic acidssecondary alcoholstricarboxylic acids and derivativesvinylogous acids |
|---|
| Substituents | phenol ethercarbonyl groupethercarboxylic acidaryl alkyl ketonebenzoxepineo-glucuronide1-hydroxy-2-unsubstituted benzenoidmonosaccharidetricarboxylic acid or derivativescarboxylic acid derivativepyran carboxylic aciddialkyl etherketone1-o-glucuronidebeta-hydroxy acidorganic oxideacetalaromatic heteropolycyclic compoundoxeteneoxaneprimary alcoholorganoheterocyclic compoundalcoholpyran carboxylic acid or derivativeshydroxy acid1-hydroxy-4-unsubstituted benzenoidoxacyclevinylogous acidpyransecondary alcoholhydrocarbon derivativebenzenoidaryl ketone |
|---|