| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 12:14:10 UTC |
|---|
| Update Date | 2025-03-24 21:32:43 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID01811437 |
|---|
| Frequency | 0.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C28H44N3O24P2+ |
|---|
| Molecular Mass | 868.1784 |
|---|
| SMILES | CC(=O)NC1C(O)CC(OCC2OC(OP(=O)(O)OP(=O)(O)OCC3OC([n+]4cccc(C(N)=O)c4)C(O)C3O)C(O)C(O)C2O)(C(=O)O)OC1C(O)C(O)CO |
|---|
| InChI Key | JLMFHBIVECORMO-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | pyridine nucleotides |
|---|
| Subclass | pyridine nucleotides |
|---|
| Direct Parent | pyridine nucleotides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetamidesazacyclic compoundsc-glucuronidescarbonyl compoundscarboxylic acidsheteroaromatic compoundshydrocarbon derivativeshydroxypyridinesketalsmethylpyridinesmonoalkyl phosphatesmonocarboxylic acids and derivativesmonosaccharidesnicotinamidesorganic cationsorganic oxidesorganic pyrophosphatesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanespentose phosphatesprimary alcoholsprimary carboxylic acid amidespyran carboxylic acidspyridinecarboxylic acids and derivativessecondary alcoholssecondary carboxylic acid amidestetrahydrofuransvinylogous amides |
|---|
| Substituents | pyridine carboxylic acid or derivativescarboxylic acidnicotinamidemonosaccharidepentose-5-phosphatepyran carboxylic acidsaccharideacetalketalorganonitrogen compoundoxaneorganoheterocyclic compoundacetamidec-glucuronidepyridine nucleotidealcoholvinylogous amideazacycleheteroaromatic compoundorganic pyrophosphatesecondary carboxylic acid amidepyridinemonoalkyl phosphatehydrocarbon derivativeprimary carboxylic acid amidecarbonyl grouparomatic heteromonocyclic compoundpentose phosphatecarboxylic acid derivativeorganic oxideorganopnictogen compoundorganic cationprimary alcoholpyran carboxylic acid or derivativestetrahydrofuranhydroxypyridinemethylpyridinecarboxamide groupoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundphosphoric acid esterpyransecondary alcoholorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphateorganooxygen compound |
|---|