| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 12:14:46 UTC |
|---|
| Update Date | 2025-03-24 21:33:00 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID01812942 |
|---|
| Frequency | 0.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C50H59N3O14 |
|---|
| Molecular Mass | 925.3997 |
|---|
| SMILES | CCC1=C(C)C(CC2=NC(=Cc3c(C)c(CCC(=O)O)c(CC4NC(=O)c5c(CCC(=O)O)c(C)c(CCC(=O)O)c(CCC(=O)O)c54)c(C)c3CCC(=O)O)C(CCC(=O)O)=C2C)NC1=O |
|---|
| InChI Key | YUEWHGGFISMOLK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | hexacarboxylic acids and derivatives |
|---|
| Direct Parent | hexacarboxylic acids and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundscarbonyl compoundscarboxylic acidshydrocarbon derivativesisoindolesisoindolonesketimineslactamsorganic oxidesorganopnictogen compoundsphenylpropanoic acidspropargyl-type 1,3-dipolar organic compoundspyrrolinessecondary carboxylic acid amidesp-xylenes |
|---|
| Substituents | ketiminemonocyclic benzene moietycarbonyl grouplactamcarboxylic acid3-phenylpropanoic-acidiminepropargyl-type 1,3-dipolar organic compoundxyleneisoindoloneorganic oxideisoindolinearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundhexacarboxylic acid or derivativesorganoheterocyclic compoundazacycleisoindoleorganic 1,3-dipolar compoundcarboxamide groupsecondary carboxylic acid amidep-xyleneorganic oxygen compoundpyrrolineisoindole or derivativeshydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compound |
|---|