| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 12:23:34 UTC |
|---|
| Update Date | 2025-03-24 21:36:41 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID01833279 |
|---|
| Frequency | 0.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H28N2O29P6 |
|---|
| Molecular Mass | 885.9203 |
|---|
| SMILES | O=c1ccn(C2OC(CO)C(OP(=O)(O)OC3C(OP(=O)(O)O)C(OP(=O)(O)O)C(OP(=O)(O)O)C(OP(=O)(O)O)C3OP(=O)(O)O)C2O)c(=O)[nH]1 |
|---|
| InChI Key | JXXSQHDKBUWJLZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | inositol phosphates |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsdialkyl phosphatesheteroaromatic compoundshydrocarbon derivativeslactamsmonoalkyl phosphatesmonosaccharidesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundspentose phosphatesprimary alcoholspyrimidonesribonucleoside 3'-phosphatessecondary alcoholstetrahydrofuransvinylogous amides |
|---|
| Substituents | lactamaromatic heteromonocyclic compoundpentose phosphatemonosaccharidepyrimidoneinositol phosphatepyrimidinesaccharideorganic oxideorganonitrogen compoundorganopnictogen compoundprimary alcoholorganoheterocyclic compoundribonucleoside 3'-phosphatevinylogous amidecarbonic acid derivativeazacycletetrahydrofuranheteroaromatic compoundoxacycledialkyl phosphatephosphoric acid estermonoalkyl phosphatesecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphate |
|---|
