| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 12:36:01 UTC |
|---|
| Update Date | 2025-03-24 21:42:14 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID01863067 |
|---|
| Frequency | 0.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C26H36N10O25P4 |
|---|
| Molecular Mass | 1012.0804 |
|---|
| SMILES | Nc1ncnc2c1ncn2C1OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)OP(=O)(O)OCC2OC(n3cnc4c(N)ncnc43)C(OC3OC(C(=O)O)C(O)C(O)C3O)C2O)C(O)C1O |
|---|
| InChI Key | QGGZUFQBSTUMEZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | monosaccharides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | acetalsamino acidsazacyclic compoundsbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsglucuronic acid derivativesheteroaromatic compoundshydrocarbon derivativesimidazolesimidolactamsmonoalkyl phosphatesmonocarboxylic acids and derivativesn-substituted imidazoleso-glucuronidesorganic oxidesorganopnictogen compoundsoxacyclic compoundsoxanespentose phosphatesprimary aminespurine ribonucleoside monophosphatespurines and purine derivativespyran carboxylic acidspyrimidines and pyrimidine derivativessecondary alcoholstetrahydrofurans |
|---|
| Substituents | carboxylic acidamino acid or derivativespurine ribonucleoside monophosphateo-glucuronidemonosaccharidepentose-5-phosphateimidazopyrimidinepyran carboxylic acid1-o-glucuronidebeta-hydroxy acidacetalorganonitrogen compoundoxaneorganoheterocyclic compoundalcoholazacycleheteroaromatic compoundmonoalkyl phosphatehydrocarbon derivativeprimary amineaminecarbonyl groupglucuronic acid or derivativespentose phosphateamino acidcarboxylic acid derivativepyrimidineorganic oxidearomatic heteropolycyclic compoundimidazoleorganopnictogen compoundimidolactamazolen-substituted imidazolepyran carboxylic acid or derivativestetrahydrofuranhydroxy acidoxacyclemonocarboxylic acid or derivativesphosphoric acid esterpyransecondary alcoholpurineorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphate |
|---|