Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 12:37:29 UTC |
---|
Update Date | 2025-03-24 21:42:52 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID01866450 |
---|
Frequency | 0.7 |
---|
Structure | |
---|
Chemical Formula | C50H82N12O11S2 |
---|
Molecular Mass | 1090.5667 |
---|
SMILES | CCC(C)C1NC(=O)C(Cc2ccc(O)cc2)NC(=O)C(N)CSSCC(C(=O)N2CCCC2C(NC(=O)CCCCN)C(C)CC)NC(=O)C(CC(N)=O)NC(=O)C(CCC(N)=O)NC(=O)C(C(C)CC)NC1=O |
---|
InChI Key | KSFBUNFNMHSRTG-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic polymers |
---|
Class | polypeptides |
---|
Subclass | polypeptides |
---|
Direct Parent | polypeptides |
---|
Geometric Descriptor | aromatic heteromonocyclic compounds |
---|
Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalpha amino acidsazacyclic compoundsbenzene and substituted derivativescarbonyl compoundscarboxylic acids and derivativescyclic peptidesdelta amino acids and derivativeshydrocarbon derivativeslactamsmonoalkylaminesn-acyl aminesn-acylpyrrolidinesorganic disulfidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsprimary carboxylic acid amidessecondary carboxylic acid amidestertiary carboxylic acid amides |
---|
Substituents | primary carboxylic acid amidefatty acylmonocyclic benzene moietycarbonyl grouplactamaromatic heteromonocyclic compoundfatty amiden-acylpyrrolidine1-hydroxy-2-unsubstituted benzenoidalpha-amino acid or derivativescarboxylic acid derivativeorganic oxidetertiary carboxylic acid amideorganonitrogen compoundalpha-amino acidorganopnictogen compounddelta amino acid or derivativespyrrolidineorganoheterocyclic compoundpolypeptideazacyclecarboxamide groupn-acyl-aminesecondary carboxylic acid amideorganic oxygen compoundcyclic alpha peptideorganic disulfidephenolhydrocarbon derivativebenzenoidprimary aliphatic amineorganic nitrogen compoundorganooxygen compound |
---|