| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 12:37:44 UTC |
|---|
| Update Date | 2025-03-24 21:42:58 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID01867020 |
|---|
| Frequency | 0.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C30H52NO27P |
|---|
| Molecular Mass | 889.2464 |
|---|
| SMILES | CC(=O)NC1C(OC2C(O)C(CO)OC(OC(C(O)CO)C(O)C(O)C=O)C2O)OC(C(O)COC2OC(C(O)CO)C(OP(=O)(O)O)C(O)C2O)C(O)C1OC(C)=O |
|---|
| InChI Key | QUZYTPXYUXUTLK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | hexose phosphates |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalsacetamidesalkyl glycosidesalpha-hydroxyaldehydesbeta-hydroxy aldehydescarboxylic acid estersfatty acyl glycosides of mono- and disaccharideshydrocarbon derivativesmonoalkyl phosphatesmonocarboxylic acids and derivativesmonosaccharidesn-acyl-alpha-hexosaminesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholssecondary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | fatty acylfatty acyl glycoside of mono- or disaccharidebeta-hydroxy aldehydecarbonyl groupcarboxylic acid derivativen-acyl-alpha-hexosamineorganic oxidealpha-hydroxyaldehydeacetalaliphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundoxaneprimary alcoholorganoheterocyclic compoundacetamidealcoholfatty acyl glycosidealdehydecarboxamide groupoxacyclesecondary carboxylic acid amidemonocarboxylic acid or derivativesphosphoric acid estermonoalkyl phosphatecarboxylic acid esterhexose phosphatesecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphatealkyl glycoside |
|---|
