| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 12:38:56 UTC |
|---|
| Update Date | 2025-03-24 21:43:23 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID01869859 |
|---|
| Frequency | 0.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C45H44N4O19 |
|---|
| Molecular Mass | 944.26 |
|---|
| SMILES | O=C(O)CCC1=C2C=C3N=C(N=C2C=c2[nH]c(c(CCC(=O)O)c2CC(=O)O)=CC(C(O)CC(=O)O)=NC2=CC(=C1CC(=O)O)C(CCC(=O)O)=C2CCC(=O)O)C(CCC(=O)O)=C3CC(=O)O |
|---|
| InChI Key | DMIYZDGEPIZAFC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | hydroxy acids and derivatives |
|---|
| Subclass | beta hydroxy acids and derivatives |
|---|
| Direct Parent | beta hydroxy acids and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | aromatic alcoholsazacyclic compoundscarbonyl compoundscarboxylic acidsheteroaromatic compoundshydrocarbon derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundspyrrolessecondary alcohols |
|---|
| Substituents | aromatic alcoholalcoholcarbonyl groupcarboxylic acidazacycleheteroaromatic compoundcarboxylic acid derivativebeta-hydroxy acidorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundpyrroleorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganoheterocyclic compoundorganooxygen compound |
|---|