| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 12:52:55 UTC |
|---|
| Update Date | 2025-03-24 21:49:26 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID01902510 |
|---|
| Frequency | 0.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C38H65NO30 |
|---|
| Molecular Mass | 1015.3591 |
|---|
| SMILES | CC(=O)NC1C(OC2C(O)C(OOC3OC(CO)C(OC4OC(CO)C(O)C(O)C4O)C3O)CC(CO)C2OC2OC(CO)C(O)C(O)C2O)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O |
|---|
| InChI Key | CLZJPWFYLHLRCX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | n-acyl-alpha-hexosamines |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalsacetamidescarbonyl compoundscarboxylic acids and derivativescyclitols and derivativescyclohexanolsdialkyl peroxideshydrocarbon derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholssecondary carboxylic acid amidestetrahydrofurans |
|---|
| Substituents | carbonyl groupmonosaccharidecarboxylic acid derivativen-acyl-alpha-hexosamineorganic oxideacetaldialkyl peroxidealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundoxaneprimary alcoholorganoheterocyclic compoundacetamidealcoholtetrahydrofurancyclohexanolcyclitol or derivativescyclic alcoholcarboxamide groupoxacyclesecondary carboxylic acid amidesecondary alcoholhydrocarbon derivativeorganic nitrogen compound |
|---|