| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 13:01:13 UTC |
|---|
| Update Date | 2025-03-24 21:53:13 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID01922276 |
|---|
| Frequency | 0.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C50H93NO13 |
|---|
| Molecular Mass | 915.6647 |
|---|
| SMILES | CCCCCCCC=CCCCCCCCC(=O)NC(COC1OC(CO)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O)C(O)CCCCCCCC=CCCCCCCCCC |
|---|
| InChI Key | MOYONOWEFUSUKO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | sphingolipids |
|---|
| Subclass | glycosphingolipids |
|---|
| Direct Parent | glycosphingolipids |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalsalkyl glycosidescarbonyl compoundscarboxylic acids and derivativesfatty acyl glycosides of mono- and disaccharideshydrocarbon derivativesmonosaccharidesn-acyl aminesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholssecondary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | fatty acylfatty acyl glycoside of mono- or disaccharidecarbonyl groupfatty amidemonosaccharideglycosphingolipidcarboxylic acid derivativesaccharideorganic oxideacetalaliphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundoxaneprimary alcoholorganoheterocyclic compoundalcoholfatty acyl glycosidecarboxamide groupn-acyl-amineoxacyclesecondary carboxylic acid amideorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganooxygen compoundalkyl glycoside |
|---|