| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 13:18:20 UTC |
|---|
| Update Date | 2025-03-24 22:00:45 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID01962738 |
|---|
| Frequency | 0.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C38H62N2O29 |
|---|
| Molecular Mass | 1010.3438 |
|---|
| SMILES | CC(=O)NC1C(O)CC(COC2(C(=O)O)CC(OC3(C(=O)O)CC(O)C(NC(C)=O)C(C(O)C(O)CO)O3)C(O)C(CO)O2)OC1OC1C(O)C(CO)OC(OC(C(O)CO)C(O)C(O)C=O)C1O |
|---|
| InChI Key | HRAOELYUMSRCMU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | fatty acyls |
|---|
| Subclass | fatty acyl glycosides |
|---|
| Direct Parent | fatty acyl glycosides of mono- and disaccharides |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetamidesalkyl glycosidesalpha-hydroxyaldehydesbeta-hydroxy aldehydesc-glucuronidescarboxylic acidsdicarboxylic acids and derivativeshydrocarbon derivativesketalsmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholspyran carboxylic acidssecondary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | fatty acyl glycoside of mono- or disaccharidebeta-hydroxy aldehydecarbonyl groupcarboxylic acidmonosaccharidecarboxylic acid derivativepyran carboxylic acidsaccharideorganic oxidealpha-hydroxyaldehydeacetalketalaliphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundoxaneprimary alcoholorganoheterocyclic compoundacetamidec-glucuronidealcoholpyran carboxylic acid or derivativesaldehydecarboxamide groupoxacyclesecondary carboxylic acid amideorganic oxygen compoundpyransecondary alcoholdicarboxylic acid or derivativeshydrocarbon derivativeorganic nitrogen compoundorganooxygen compoundalkyl glycoside |
|---|