| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 13:22:41 UTC |
|---|
| Update Date | 2025-03-24 22:02:42 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID01973035 |
|---|
| Frequency | 0.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C42H65N11O7S |
|---|
| Molecular Mass | 867.4789 |
|---|
| SMILES | CSCCC(NC(=O)C(CC(C)C)NC(=O)CNC(=O)C(Cc1ccccc1)NC(=O)C(Cc1ccccc1)NC(=O)C(CCCNC(=N)N)NC(=O)C(N)C(C)C)C(N)=O |
|---|
| InChI Key | YFKLOQWEWSFOPA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic polymers |
|---|
| Class | polypeptides |
|---|
| Subclass | polypeptides |
|---|
| Direct Parent | polypeptides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alpha amino acid amidesalpha amino acidsamphetamines and derivativesarginine and derivativesbenzene and substituted derivativescarbonyl compoundscarboximidamidescarboxylic acids and derivativesdialkylthioethersguanidineshydrocarbon derivativesiminesleucine and derivativesmethionine and derivativesmonoalkylaminesn-acyl aminesn-acyl-alpha amino acidsorganic oxidesorganopnictogen compoundspeptidesphenylalanine and derivativesprimary carboxylic acid amidessecondary carboxylic acid amidessulfenyl compoundsvaline and derivatives |
|---|
| Substituents | primary carboxylic acid amidefatty acylmonocyclic benzene moietycarbonyl groupguanidineiminefatty amidealpha-amino acid or derivativesorganosulfur compoundcarboxylic acid derivativealpha peptideorganic oxidearginine or derivativesleucine or derivativesorganonitrogen compoundalpha-amino acidorganopnictogen compoundamphetamine or derivativesn-acyl-alpha amino acid or derivativespolypeptidesulfenyl compoundalpha-amino acid amiden-acyl-alpha-amino aciddialkylthioethervaline or derivativescarboximidamidecarboxamide groupn-acyl-aminen-substituted-alpha-amino acidaromatic homomonocyclic compoundsecondary carboxylic acid amidephenylalanine or derivativesorganic oxygen compoundthioethermethionine or derivativeshydrocarbon derivativebenzenoidprimary aliphatic amineorganic nitrogen compoundorganooxygen compound |
|---|