| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 13:27:34 UTC |
|---|
| Update Date | 2025-03-24 22:04:58 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID01984858 |
|---|
| Frequency | 0.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C38H64N2O29 |
|---|
| Molecular Mass | 1012.3595 |
|---|
| SMILES | CC(=O)NC1C(O)CC(OCC2C(O)C(O)C(O)C(OC3OC(CO)C(OC4OC(OC(C(O)CO)C(O)C(O)C=O)C(O)C(CO)C4O)C(NC(C)=O)C3O)C2O)(C(=O)O)OC(C(O)CO)C1O |
|---|
| InChI Key | NJBSZTPYKDKZPK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | oxepanes |
|---|
| Subclass | oxepanes |
|---|
| Direct Parent | oxepanes |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetamidesalpha-hydroxyaldehydesbeta-hydroxy aldehydescarboxylic acidscyclitols and derivativescyclohexanolshydrocarbon derivativesketalsmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | beta-hydroxy aldehydecarbonyl groupcarboxylic acidmonosaccharidecarboxylic acid derivativesaccharideorganic oxidealpha-hydroxyaldehydeacetalketalaliphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundoxaneprimary alcoholacetamidealcoholcyclohexanolaldehydecyclitol or derivativescyclic alcoholcarboxamide groupoxepaneoxacyclesecondary carboxylic acid amidemonocarboxylic acid or derivativesorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
