| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 13:27:38 UTC |
|---|
| Update Date | 2025-03-24 22:04:59 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID01985016 |
|---|
| Frequency | 0.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C38H61N3O29 |
|---|
| Molecular Mass | 1023.3391 |
|---|
| SMILES | CC(=O)NC1C(O)CC(OCC2OC(OC3C(O)C(NC(C)=O)C(OC4C(O)C(CO)OC(OC(C(O)CO)C(O)C(O)C=O)C4O)C(NC(C)=O)C3O)OC(CO)C2O)(C(=O)O)OC1C(O)C(=O)O |
|---|
| InChI Key | IGEOGGFTOCNZKG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | fatty acyls |
|---|
| Subclass | fatty acyl glycosides |
|---|
| Direct Parent | fatty acyl glycosides of mono- and disaccharides |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,3-dioxanesacetamidesalkyl glycosidesalpha hydroxy acids and derivativesalpha-hydroxyaldehydesbeta-hydroxy aldehydesc-glucuronidescarboxylic acid orthoesterscarboxylic acidscyclitols and derivativescyclohexanolsdialkyl ethersdicarboxylic acids and derivativesgamma amino acids and derivativeshydrocarbon derivativesketalsmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsortho estersoxacyclic compoundsoxanesprimary alcoholspyran carboxylic acidssecondary carboxylic acid amides |
|---|
| Substituents | fatty acyl glycoside of mono- or disaccharidecarboxylic acidmonosaccharidecarboxylic acid orthoesterpyran carboxylic aciddialkyl ethersaccharideacetalketalorganonitrogen compoundorthocarboxylic acid derivativeoxaneorganoheterocyclic compoundacetamidec-glucuronidealcoholcyclohexanolcyclitol or derivativessecondary carboxylic acid amidedicarboxylic acid or derivativeshydrocarbon derivativemeta-dioxanebeta-hydroxy aldehydecarbonyl groupetherortho estergamma amino acid or derivativesalpha-hydroxy acidcarboxylic acid derivativeorganic oxidealpha-hydroxyaldehydealiphatic heteromonocyclic compoundorganopnictogen compoundprimary alcoholpyran carboxylic acid or derivativesaldehydehydroxy acidcyclic alcoholcarboxamide groupoxacycleorganic oxygen compoundpyransecondary alcoholorganic nitrogen compoundorganooxygen compoundalkyl glycoside |
|---|