| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 13:28:22 UTC |
|---|
| Update Date | 2025-03-24 22:05:17 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID01986775 |
|---|
| Frequency | 0.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C30H52N2O32S4 |
|---|
| Molecular Mass | 1080.1386 |
|---|
| SMILES | CC(=O)NC1C(O)CC(COS(C)(=O)=O)OC1OC1C(O)C(COS(=O)(=O)O)OC(OC2C(COS(=O)(=O)O)OC(OC3C(O)C(O)OC(COS(=O)(=O)O)C(O)C3O)C(NC(C)=O)C2O)C1O |
|---|
| InChI Key | DWLLDDCUBSTGNU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | n-acyl-alpha-hexosamines |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalsacetamidesalkyl sulfatescarbonyl compoundscarboxylic acids and derivativeshemiacetalshydrocarbon derivativesmethanesulfonatesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsorganosulfonic acid estersoxacyclic compoundsoxanesoxepanessecondary alcoholssecondary carboxylic acid amidessulfonic acid esterssulfonylssulfuric acid monoesters |
|---|
| Substituents | organosulfonic acid or derivativessulfuric acid monoestercarbonyl groupmonosaccharideorganosulfur compoundcarboxylic acid derivativen-acyl-alpha-hexosaminesulfonic acid esterorganic oxideacetalalkyl sulfatealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundhemiacetaloxaneorganoheterocyclic compoundacetamidealcoholorganic sulfuric acid or derivativescarboxamide grouporganosulfonic acid estermethanesulfonateoxepaneoxacyclesecondary carboxylic acid amidesulfonylorganic sulfonic acid or derivativessecondary alcoholsulfate-esterhydrocarbon derivativeorganic nitrogen compoundsulfuric acid ester |
|---|