| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 13:29:59 UTC |
|---|
| Update Date | 2025-03-24 22:06:01 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID01990669 |
|---|
| Frequency | 0.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C61H109N2O58P3 |
|---|
| Molecular Mass | 1890.4854 |
|---|
| SMILES | CC(=O)NC1C(OC2C(OC3C(OC4C(O)C(COC5OC(CO)C(O)C(O)C5O)OC(OC5C(O)C(OC6C(O)C(OC7OC(CO)C(O)C(O)C7O)OC(C(O)CO)C6OP(=O)(O)OP(=O)(O)OCCN)OC(C(O)COC6OC(C(O)CO)C(OP(=O)(O)O)C(O)C6O)C5O)C4O)OC(CO)C(O)C3O)OC(CO)C(O)C2O)OC(CO)C(O)C1O |
|---|
| InChI Key | SOYRLUWRXBKMEH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | hexose phosphates |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalsacetamidescarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesmonoalkyl phosphatesmonoalkylaminesmonosaccharidesn-acyl-alpha-hexosaminesorganic oxidesorganic pyrophosphatesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesphosphoethanolaminesprimary alcoholssecondary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | carbonyl groupcarboxylic acid derivativen-acyl-alpha-hexosaminephosphoethanolamineorganic oxideacetalaliphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundoxaneprimary alcoholorganoheterocyclic compoundacetamidealcoholcarboxamide grouporganic pyrophosphateoxacyclesecondary carboxylic acid amidephosphoric acid estermonoalkyl phosphatehexose phosphatesecondary alcoholhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphate |
|---|