| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 13:33:27 UTC |
|---|
| Update Date | 2025-03-24 22:07:26 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID01998761 |
|---|
| Frequency | 0.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C23H41N3O26S4 |
|---|
| Molecular Mass | 903.0861 |
|---|
| SMILES | CC(=O)NC1C(O)CC(COS(=O)(=O)O)OC1OC1C(O)C(COS(=O)(=O)O)C(OC2C(COS(=O)(=O)O)OC(O)C(NS(=O)(=O)O)C2O)C(NC(C)=O)C1O |
|---|
| InChI Key | JYIUDTCNEOZNJK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | cyclohexanols |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalsacetamidesalkyl sulfatescarbonyl compoundscarboxylic acids and derivativescyclitols and derivativesdialkyl ethershemiacetalshydrocarbon derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanessecondary carboxylic acid amidessulfuric acid monoamidessulfuric acid monoesters |
|---|
| Substituents | sulfuric acid monoestercarbonyl groupethermonosaccharidecarboxylic acid derivativedialkyl ethersaccharideorganic oxideacetalalkyl sulfatealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundhemiacetaloxaneorganoheterocyclic compoundacetamideorganic sulfuric acid or derivativescyclohexanolcyclitol or derivativescyclic alcoholcarboxamide groupoxacyclesecondary carboxylic acid amidesulfuric acid monoamidesulfate-esterhydrocarbon derivativeorganic nitrogen compoundsulfuric acid ester |
|---|