| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 13:34:42 UTC |
|---|
| Update Date | 2025-03-24 22:07:59 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02001834 |
|---|
| Frequency | 0.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C40H68N2O39S3 |
|---|
| Molecular Mass | 1296.2561 |
|---|
| SMILES | CC(=O)NC1C(O)CC(COS(=O)(=O)O)OC1OC1C(O)C(COS(=O)(=O)O)OC(OC2C(COS(=O)(=O)O)OC(OC3C(O)C(CO)OC(OC4C(O)C(CO)OC(OC(C(O)CO)C(O)C(O)C=O)C4O)C3O)C(NC(C)=O)C2O)C1O |
|---|
| InChI Key | NJCLABTUEDEGNE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | n-acyl-alpha-hexosamines |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalsacetamidesalkyl glycosidesalkyl sulfatesalpha-hydroxyaldehydesbeta-hydroxy aldehydescarboxylic acids and derivativesfatty acyl glycosides of mono- and disaccharideshydrocarbon derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholssecondary alcoholssecondary carboxylic acid amidessulfuric acid monoesters |
|---|
| Substituents | fatty acylfatty acyl glycoside of mono- or disaccharidebeta-hydroxy aldehydesulfuric acid monoestercarbonyl groupmonosaccharidecarboxylic acid derivativen-acyl-alpha-hexosamineorganic oxidealpha-hydroxyaldehydeacetalalkyl sulfatealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundoxaneprimary alcoholorganoheterocyclic compoundacetamidealcoholorganic sulfuric acid or derivativesfatty acyl glycosidealdehydecarboxamide groupoxacyclesecondary carboxylic acid amidesecondary alcoholsulfate-esterhydrocarbon derivativeorganic nitrogen compoundsulfuric acid esteralkyl glycoside |
|---|
