| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 13:43:48 UTC |
|---|
| Update Date | 2025-03-24 22:11:55 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02023666 |
|---|
| Frequency | 0.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C34H59NO26 |
|---|
| Molecular Mass | 897.3325 |
|---|
| SMILES | CC(=O)NC1C(OCC2C(O)C(O)C(O)C(OC3C(CO)OC(OC4C(CO)OC(O)C(O)C4O)OC3CO)C2O)CC(O)OC(CO)C1OC1OC(CO)C(O)C(O)C1O |
|---|
| InChI Key | RIWPJSOEHSDIAG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | oxepanes |
|---|
| Subclass | oxepanes |
|---|
| Direct Parent | oxepanes |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,3-dioxanesacetalsacetamidescarbonyl compoundscarboxylic acid orthoesterscarboxylic acids and derivativescyclitols and derivativescyclohexanolsdialkyl ethershemiacetalshydrocarbon derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsortho estersoxacyclic compoundsoxanesprimary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | carbonyl groupetherortho estermonosaccharidecarboxylic acid orthoestercarboxylic acid derivativedialkyl ethersaccharideorganic oxideacetalaliphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundhemiacetalorthocarboxylic acid derivativeoxaneprimary alcoholacetamidealcoholcyclohexanolcyclitol or derivativescyclic alcoholcarboxamide groupoxepaneoxacyclesecondary carboxylic acid amideorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganic nitrogen compoundmeta-dioxaneorganooxygen compound |
|---|