| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 13:43:57 UTC |
|---|
| Update Date | 2025-03-24 22:11:58 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02024051 |
|---|
| Frequency | 0.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C52H75N13O14S4 |
|---|
| Molecular Mass | 1233.4439 |
|---|
| SMILES | CC(C)CC(NC(=O)C1CCCN1C(=O)C1CSSCC(N)C(=O)NC(Cc2ccc(O)cc2)C(=O)NC(C(=O)N2CCCC2C(=O)NC(CCCN=C(N)N)C(=O)O)CSSCC(N)C(=O)NC(Cc2ccc(O)cc2)C(=O)N1)C(=O)O |
|---|
| InChI Key | QBXBWUKNVPLCDC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic polymers |
|---|
| Class | polypeptides |
|---|
| Subclass | polypeptides |
|---|
| Direct Parent | polypeptides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalpha amino acid amidesalpha amino acidsazacyclic compoundsbenzene and substituted derivativescarbonyl compoundscarboximidamidescarboxylic acidscyclic peptidesdicarboxylic acids and derivativesguanidineshydrocarbon derivativeslactamsleucine and derivativesmonoalkylaminesn-acyl-alpha amino acidsn-acylpyrrolidinesorganic disulfidesorganic oxidesorganopnictogen compoundsproline and derivativespropargyl-type 1,3-dipolar organic compoundspyrrolidinecarboxamidessecondary carboxylic acid amidestertiary carboxylic acid amides |
|---|
| Substituents | monocyclic benzene moietycarbonyl grouplactamcarboxylic acidaromatic heteromonocyclic compoundguanidinen-acylpyrrolidine1-hydroxy-2-unsubstituted benzenoidalpha-amino acid or derivativescarboxylic acid derivativepropargyl-type 1,3-dipolar organic compoundorganic oxideleucine or derivativestertiary carboxylic acid amideorganonitrogen compoundalpha-amino acidorganopnictogen compoundpyrrolidineorganoheterocyclic compoundn-acyl-alpha amino acid or derivativesproline or derivativespolypeptidealpha-amino acid amideazacyclen-acyl-alpha-amino acidorganic 1,3-dipolar compoundcarboximidamidecarboxamide groupsecondary carboxylic acid amidepyrrolidine carboxylic acid or derivativesorganic oxygen compoundcyclic alpha peptideorganic disulfidedicarboxylic acid or derivativesphenolhydrocarbon derivativebenzenoidprimary aliphatic amineorganic nitrogen compoundpyrrolidine-2-carboxamideorganooxygen compound |
|---|