| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:13:25 UTC |
|---|
| Update Date | 2025-03-25 00:37:00 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02093846 |
|---|
| Frequency | 0.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H15I4N3O7S |
|---|
| Molecular Mass | 924.681 |
|---|
| SMILES | NC(Cc1cc(I)c(Oc2cc(I)c(OS(=O)(=O)O)c(I)c2)c(I)c1)CC1NC(=O)C(=O)N1 |
|---|
| InChI Key | PNAIRVKELDUNQH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylethers |
|---|
| Direct Parent | diphenylethers |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | alpha amino acidsamphetamines and derivativesaryl iodidesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativesdiarylethershydrocarbon derivativesimidazolidinonesiodobenzeneslactamsmonoalkylaminesorganic oxidesorganoiodidesorganonitrogen compoundsorganopnictogen compoundsphenol ethersphenoxy compoundsphenylsulfatessecondary carboxylic acid amidessulfuric acid monoesters |
|---|
| Substituents | imidazolidinediaryl etherphenol ethersulfuric acid monoestercarbonyl groupetherlactamaromatic heteromonocyclic compoundalpha-amino acid or derivativescarboxylic acid derivativeorganohalogen compoundiodobenzeneorganoiodidephenylsulfateimidazolidinoneorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundarylsulfateorganoheterocyclic compoundamphetamine or derivativesorganic sulfuric acid or derivativesazacyclecarboxamide grouparyl halidesecondary carboxylic acid amideorganic oxygen compoundsulfate-esterhydrocarbon derivativeprimary aliphatic aminearyl iodideorganic nitrogen compoundhalobenzenephenoxy compoundsulfuric acid esterdiphenyletherorganooxygen compound |
|---|
