| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:27:50 UTC |
|---|
| Update Date | 2025-03-25 00:42:11 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02127665 |
|---|
| Frequency | 0.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C47H92NO12P |
|---|
| Molecular Mass | 893.6357 |
|---|
| SMILES | CCCCCCC=CCCCCCCCC(=O)NC(COP(=O)(O)OCCOCCOCCOCCOCCOCCO)C(O)CCCCCCCC=CCCCCCCC |
|---|
| InChI Key | PCWYKSMGDXLQCL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic phosphoric acids and derivatives |
|---|
| Subclass | phosphate esters |
|---|
| Direct Parent | phosphoethanolamines |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acids and derivativesdialkyl ethersdialkyl phosphateshydrocarbon derivativesn-acyl aminesorganic oxidesorganonitrogen compoundsorganopnictogen compoundssecondary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | fatty acylaliphatic acyclic compoundcarbonyl groupetherfatty amidecarboxylic acid derivativedialkyl etherphosphoethanolamineorganic oxideorganonitrogen compoundorganopnictogen compoundalcoholcarboxamide groupn-acyl-aminesecondary carboxylic acid amidedialkyl phosphateorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganic nitrogen compoundalkyl phosphateorganooxygen compound |
|---|
