| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:31:26 UTC |
|---|
| Update Date | 2025-03-25 00:43:25 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02136027 |
|---|
| Frequency | 0.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C31H50N7O15P3S |
|---|
| Molecular Mass | 885.2298 |
|---|
| SMILES | CCCC=CC=CC(C)SCCNC(=O)CCNC(=O)C(=O)C(C)(C)COP(=O)(O)OP(=O)(O)OCC1OC(n2cnc3c(N)ncnc32)C(O)C1CP(=O)(O)O |
|---|
| InChI Key | SCZGZXZBBOZXQK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | purine nucleotides |
|---|
| Subclass | purine deoxyribonucleotides |
|---|
| Direct Parent | purine 3'-deoxyribonucleoside diphosphates |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsbeta amino acids and derivativescarboxylic acids and derivativesdialkylthioethersheteroaromatic compoundshydrocarbon derivativesimidazolesimidolactamsketonesmonoalkyl phosphatesn-acyl aminesn-substituted imidazolesorganic oxidesorganic phosphonic acids and derivativesorganic pyrophosphatesorganophosphorus compoundsorganopnictogen compoundsoxacyclic compoundspentose phosphatesprimary aminespurines and purine derivativespyrimidines and pyrimidine derivativessecondary alcoholssecondary carboxylic acid amidessulfenyl compoundstetrahydrofurans |
|---|
| Substituents | fatty acylcarbonyl grouppentose phosphateamino acid or derivativesfatty amideimidazopyrimidineorganosulfur compoundcarboxylic acid derivativepyrimidineketoneorganic oxidearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundorganophosphorus compoundimidolactamorganophosphonic acid derivativeorganoheterocyclic compoundazolen-substituted imidazolealcoholsulfenyl compoundazacycletetrahydrofurandialkylthioetherheteroaromatic compoundpurine 3'-deoxyribonucleoside diphosphatecarboxamide groupn-acyl-aminebeta amino acid or derivativesorganic pyrophosphateoxacyclesecondary carboxylic acid amideorganic oxygen compoundphosphoric acid esterthioethermonoalkyl phosphatesecondary alcoholhydrocarbon derivativeprimary aminepurineorganic nitrogen compoundorganic phosphoric acid derivativeaminealkyl phosphateorganooxygen compound |
|---|