| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:32:11 UTC |
|---|
| Update Date | 2025-03-25 00:43:39 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02137670 |
|---|
| Frequency | 0.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C41H61NO28 |
|---|
| Molecular Mass | 1015.338 |
|---|
| SMILES | CC(=O)NC1C(OC2C(O)C(COC(=O)C=Cc3ccc(O)c(O)c3)OC(OC(C(O)CO)C(O)C(O)C=O)C2O)OC(CO)C(OC2OC(CO)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O |
|---|
| InChI Key | JOFVBHXITGYIER-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | n-acyl-alpha-hexosamines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsacetalsacetamidesalkyl glycosidesalpha-hydroxyaldehydesbenzene and substituted derivativesbeta-hydroxy aldehydesenoate estersfatty acid estersfatty acyl glycosides of mono- and disaccharideshydrocarbon derivativeshydroxycinnamic acidsmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholssecondary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | fatty acylfatty acyl glycoside of mono- or disaccharidemonocyclic benzene moietycarbonyl groupbeta-hydroxy aldehydearomatic heteromonocyclic compound1-hydroxy-2-unsubstituted benzenoidmonosaccharidecarboxylic acid derivativehydroxycinnamic acid or derivativesn-acyl-alpha-hexosaminealpha,beta-unsaturated carboxylic estercinnamic acid or derivativesorganic oxidealpha-hydroxyaldehydeacetalorganonitrogen compoundorganopnictogen compoundoxaneprimary alcoholorganoheterocyclic compoundacetamideenoate esteralcoholfatty acyl glycosidealdehyde1-hydroxy-4-unsubstituted benzenoidcarboxamide grouphydroxycinnamic acidoxacyclesecondary carboxylic acid amidefatty acid estermonocarboxylic acid or derivativescarboxylic acid estersecondary alcoholphenolhydrocarbon derivativebenzenoidorganic nitrogen compoundalkyl glycoside |
|---|