| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:37:01 UTC |
|---|
| Update Date | 2025-03-25 00:45:23 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02148803 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H14O4 |
|---|
| Molecular Mass | 282.0892 |
|---|
| SMILES | O=C(CCc1ccc(O)cc1)c1c(O)ccc2ccoc12 |
|---|
| InChI Key | XHGQDDAVLWGXGD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | linear 1,3-diarylpropanoids |
|---|
| Subclass | chalcones and dihydrochalcones |
|---|
| Direct Parent | 2'-hydroxy-dihydrochalcones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsaryl alkyl ketonesbenzofuransbutyrophenonesfuransheteroaromatic compoundshydrocarbon derivativesorganic oxidesorganooxygen compoundsoxacyclic compoundsvinylogous acids |
|---|
| Substituents | furanmonocyclic benzene moiety2'-hydroxy-dihydrochalconearyl alkyl ketonebenzofuranheteroaromatic compound1-hydroxy-2-unsubstituted benzenoidketonebutyrophenoneoxacyclevinylogous acidorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundphenolhydrocarbon derivativebenzenoidorganoheterocyclic compoundorganooxygen compoundaryl ketone |
|---|
