| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:37:03 UTC |
|---|
| Update Date | 2025-03-25 00:45:24 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02148886 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H13NO3 |
|---|
| Molecular Mass | 255.0895 |
|---|
| SMILES | COc1ccc(C2(O)NC(=O)c3ccccc32)cc1 |
|---|
| InChI Key | LUFCKFOOXDPWBV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | isoindoles and derivatives |
|---|
| Subclass | isoindolines |
|---|
| Direct Parent | isoindolones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alkanolaminesalkyl aryl ethersanisolesazacyclic compoundscarboxylic acids and derivativeshydrocarbon derivativesisoindoleslactamsmethoxybenzenesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphenoxy compoundssecondary carboxylic acid amides |
|---|
| Substituents | phenol ethermonocyclic benzene moietyetherlactamalkyl aryl ethercarboxylic acid derivativeisoindoloneorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundalkanolamineazacycleisoindolecarboxamide groupmethoxybenzenesecondary carboxylic acid amideorganic oxygen compoundanisolehydrocarbon derivativebenzenoidorganic nitrogen compoundphenoxy compoundorganooxygen compound |
|---|