| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:37:03 UTC |
|---|
| Update Date | 2025-03-25 00:45:25 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02148915 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H10O5 |
|---|
| Molecular Mass | 294.0528 |
|---|
| SMILES | O=C1Oc2cc(O)cc(O)c2-c2ccc(O)c3cccc1c23 |
|---|
| InChI Key | MGWOMPGHOZLMSP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | benzoxepines |
|---|
| Subclass | benzoxepines |
|---|
| Direct Parent | benzoxepines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidscarboxylic acid estershydrocarbon derivativeslactonesmonocarboxylic acids and derivativesnaphthols and derivativesorganic oxidesorganooxygen compoundsoxacyclic compounds |
|---|
| Substituents | benzoxepine1-hydroxy-2-unsubstituted benzenoid1-hydroxy-4-unsubstituted benzenoidcarboxylic acid derivativelactoneoxacycleorganic oxidemonocarboxylic acid or derivativesnaphthaleneorganic oxygen compoundaromatic heteropolycyclic compoundcarboxylic acid esterhydrocarbon derivative1-naphtholbenzenoidorganooxygen compound |
|---|