| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:37:06 UTC |
|---|
| Update Date | 2025-03-25 00:45:26 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02149019 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C34H64NO6P |
|---|
| Molecular Mass | 613.4471 |
|---|
| SMILES | CCCCCC=CCC=CCCCCCCC(O)C(COP(=O)(O)O)NC(=O)CCCCCCCC=CCCCCC |
|---|
| InChI Key | GOFIXRKCUQUQSB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic phosphoric acids and derivatives |
|---|
| Subclass | phosphate esters |
|---|
| Direct Parent | phosphoethanolamines |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesmonoalkyl phosphatesn-acyl aminesorganic oxidesorganonitrogen compoundsorganopnictogen compoundssecondary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | alcoholfatty acylaliphatic acyclic compoundcarbonyl groupfatty amidecarboxamide groupcarboxylic acid derivativen-acyl-aminesecondary carboxylic acid amidephosphoethanolamineorganic oxideorganic oxygen compoundmonoalkyl phosphateorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundalkyl phosphateorganooxygen compound |
|---|