| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:37:09 UTC |
|---|
| Update Date | 2025-03-25 00:45:26 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02149125 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C22H30 |
|---|
| Molecular Mass | 294.2348 |
|---|
| SMILES | Cc1cc2c(cc1C)C(C)(C)C(C)(C)C1=CC=CC(C)(C)C12 |
|---|
| InChI Key | AYWCMKAYQNCRHD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | prenol lipids |
|---|
| Subclass | sesquiterpenoids |
|---|
| Direct Parent | sesquiterpenoids |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | cyclic olefinsphenanthrenes and derivativespolycyclic hydrocarbonstetralinsunsaturated aliphatic hydrocarbons |
|---|
| Substituents | tetralinphenanthrenecyclic olefinolefinaromatic homopolycyclic compoundhydrocarbonunsaturated hydrocarbonsesquiterpenoidunsaturated aliphatic hydrocarbonbenzenoidpolycyclic hydrocarboncadinane sesquiterpenoid |
|---|
