| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:37:10 UTC |
|---|
| Update Date | 2025-03-25 00:45:27 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02149170 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H15N3O3S4 |
|---|
| Molecular Mass | 304.9996 |
|---|
| SMILES | CS(=O)CCSSCCC(N)=NS(N)(=O)=O |
|---|
| InChI Key | FXBLCFKNFPFHMM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | organic sulfuric acids and derivatives |
|---|
| Direct Parent | organic sulfuric acids and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | amidinesdialkyldisulfideshydrocarbon derivativesorganic oxidesorganopnictogen compoundssulfenyl compoundssulfinyl compoundssulfoxides |
|---|
| Substituents | aliphatic acyclic compoundorganic sulfuric acid or derivativessulfenyl compoundamidineorganosulfur compounddialkyldisulfideorganic oxideorganic oxygen compoundsulfinyl compoundorganic disulfideorganonitrogen compoundsulfoxideorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compound |
|---|
