| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:37:11 UTC |
|---|
| Update Date | 2025-03-25 00:45:27 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02149190 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C20H30O2 |
|---|
| Molecular Mass | 302.2246 |
|---|
| SMILES | Cc1cc2c(cc1C(=O)O)C(C)(C)CC(C)C(C)(C)C2(C)C |
|---|
| InChI Key | MYYCZIGVQNOKPC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | carboxylic acids |
|---|
| Direct Parent | 1-carboxy-2-haloaromatic compounds |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | benzenoidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganooxygen compounds |
|---|
| Substituents | organic oxidemonocarboxylic acid or derivativesorganic oxygen compoundaromatic homopolycyclic compoundhydrocarbon derivativebenzenoid1-carboxy-2-haloaromatic compoundorganooxygen compound |
|---|
