| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:37:11 UTC |
|---|
| Update Date | 2025-03-25 00:45:27 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02149201 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H13NO3 |
|---|
| Molecular Mass | 207.0895 |
|---|
| SMILES | CN1C(=O)C(C)(O)C1c1ccc(O)cc1 |
|---|
| InChI Key | XUGOQTIKFMGING-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | azetidines |
|---|
| Subclass | phenylazetidines |
|---|
| Direct Parent | phenylazetidines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsazacyclic compoundsbenzene and substituted derivativesbeta lactamscarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundstertiary alcoholstertiary carboxylic acid amides |
|---|
| Substituents | monocyclic benzene moietycarbonyl grouplactamaromatic heteromonocyclic compound1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativeorganic oxidetertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compoundalcoholazacyclecarboxamide group2-phenylazetidinetertiary alcoholorganic oxygen compoundphenolhydrocarbon derivativebenzenoidorganic nitrogen compoundbeta-lactamorganooxygen compound |
|---|