| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:37:12 UTC |
|---|
| Update Date | 2025-03-25 00:45:27 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02149236 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H10O7P2 |
|---|
| Molecular Mass | 267.9902 |
|---|
| SMILES | O=P(O)(O)Cc1ccc(OP(=O)(O)O)cc1 |
|---|
| InChI Key | CNKIZPNVIGKCON-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic phosphoric acids and derivatives |
|---|
| Subclass | phosphate esters |
|---|
| Direct Parent | phenyl phosphates |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | hydrocarbon derivativesorganic oxidesorganic phosphonic acids and derivativesorganooxygen compoundsorganophosphorus compoundsorganopnictogen compoundsphenoxy compounds |
|---|
| Substituents | monocyclic benzene moietyphenyl phosphatearomatic homomonocyclic compoundorganic oxideorganic oxygen compoundorganopnictogen compoundorganophosphorus compoundhydrocarbon derivativebenzenoidphenoxy compoundorganophosphonic acid derivativeorganooxygen compound |
|---|
