| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:37:14 UTC |
|---|
| Update Date | 2025-03-25 00:45:28 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02149319 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H7F3N4O |
|---|
| Molecular Mass | 208.0572 |
|---|
| SMILES | Cn1nc(C(F)(F)F)c(N)c1C(N)=O |
|---|
| InChI Key | JJPHTZNCNMYSNH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | carboxylic acid derivatives |
|---|
| Direct Parent | 2-heteroaryl carboxamides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | alkyl fluoridesamino acids and derivativesazacyclic compoundscarboxylic acids and derivativesheteroaromatic compoundshydrocarbon derivativesorganic oxidesorganofluoridesorganooxygen compoundsorganopnictogen compoundsprimary aminesprimary carboxylic acid amidespyrazolesvinylogous amides |
|---|
| Substituents | primary carboxylic acid amidearomatic heteromonocyclic compoundamino acid or derivativesorganohalogen compound2-heteroaryl carboxamidepyrazoleorganic oxideorganonitrogen compoundorganopnictogen compoundalkyl halideorganoheterocyclic compoundazolevinylogous amideazacyclealkyl fluorideorganofluorideheteroaromatic compoundorganic oxygen compoundhydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|
