| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:37:14 UTC |
|---|
| Update Date | 2025-03-25 00:45:28 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02149340 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H15NO5 |
|---|
| Molecular Mass | 313.095 |
|---|
| SMILES | Nc1ccccc1C(=O)c1cccc(C(=O)CC(O)C(=O)O)c1 |
|---|
| InChI Key | SOUHAMGPXUDWJY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzophenones |
|---|
| Direct Parent | benzophenones |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl-phenylketonesalpha hydroxy acids and derivativesamino acidsaryl alkyl ketonesaryl-phenylketonesbenzoyl derivativesbeta-hydroxy ketonesbutyrophenonescarboxylic acidsdiphenylmethanesgamma-keto acids and derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganopnictogen compoundsprimary aminessecondary alcoholsvinylogous amides |
|---|
| Substituents | diphenylmethanebeta-hydroxy ketonecarbonyl groupcarboxylic acidaryl alkyl ketoneamino acid or derivativesamino acidalpha-hydroxy acidbenzoylcarboxylic acid derivativebenzophenoneketoneorganic oxideorganonitrogen compoundorganopnictogen compoundalcoholvinylogous amidearyl-phenylketonehydroxy acidphenylketonegamma-keto acidbutyrophenonearomatic homomonocyclic compoundmonocarboxylic acid or derivativesorganic oxygen compoundketo acidsecondary alcoholhydrocarbon derivativeprimary amineorganic nitrogen compoundaminealkyl-phenylketoneorganooxygen compoundaryl ketone |
|---|
