| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:37:16 UTC |
|---|
| Update Date | 2025-03-25 00:45:29 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02149405 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H16N3O8P |
|---|
| Molecular Mass | 325.0675 |
|---|
| SMILES | Nc1ccn(C(CO)C(O)C(O)COP(=O)(O)O)c(=O)n1 |
|---|
| InChI Key | HTKQNORYVWPADM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazines |
|---|
| Subclass | pyrimidines and pyrimidine derivatives |
|---|
| Direct Parent | pyrimidones |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidolactamsmonoalkyl phosphatesorganic carbonic acids and derivativesorganic oxidesorganopnictogen compoundsprimary alcoholsprimary aminessecondary alcohols |
|---|
| Substituents | aromatic heteromonocyclic compoundpyrimidoneorganic oxideorganonitrogen compoundorganopnictogen compoundprimary alcoholimidolactamalcoholcarbonic acid derivativeazacycleheteroaromatic compoundorganic oxygen compoundphosphoric acid estermonoalkyl phosphatesecondary alcoholhydrocarbon derivativeprimary amineorganic nitrogen compoundorganic phosphoric acid derivativeaminealkyl phosphateorganooxygen compound |
|---|