| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:37:16 UTC |
|---|
| Update Date | 2025-03-25 00:45:29 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02149415 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H18NO10P |
|---|
| Molecular Mass | 379.0668 |
|---|
| SMILES | NC(=O)c1cc(C2OC(COP(=O)(O)O)C(O)C(O)C2O)ccc1O |
|---|
| InChI Key | MQMAUCPURCAIEF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | hexose phosphates |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsbenzamidesbenzoyl derivativescarboxylic acids and derivativesdialkyl ethershydrocarbon derivativesmonoalkyl phosphatesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesprimary carboxylic acid amidessalicylamidessecondary alcoholsvinylogous acids |
|---|
| Substituents | primary carboxylic acid amidemonocyclic benzene moietyetheraromatic heteromonocyclic compoundbenzoyl1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativedialkyl etherbenzamideorganic oxideorganonitrogen compoundorganopnictogen compoundoxaneorganoheterocyclic compoundalcoholbenzoic acid or derivativescarboxamide groupsalicylamideoxacyclevinylogous acidsalicylic acid or derivativesphosphoric acid estermonoalkyl phosphatesecondary alcoholhexose phosphatephenolhydrocarbon derivativebenzenoidorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphate |
|---|
