| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:37:19 UTC |
|---|
| Update Date | 2025-03-25 00:45:30 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02149519 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H17N2O2+ |
|---|
| Molecular Mass | 209.1285 |
|---|
| SMILES | C[N+](C)(C)Oc1ccc(CC(N)=O)cc1 |
|---|
| InChI Key | UNZQNANCCDBBSP-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenylacetamides |
|---|
| Direct Parent | phenylacetamides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesn-organohydroxylaminesorganic cationsorganic oxidesorganopnictogen compoundsphenoxy compoundsprimary carboxylic acid amides |
|---|
| Substituents | primary carboxylic acid amidecarbonyl groupcarboxamide groupcarboxylic acid derivativen-organohydroxylaminearomatic homomonocyclic compoundorganic oxideorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganic cationphenoxy compoundphenylacetamideorganooxygen compound |
|---|
