Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 14:37:21 UTC |
---|
Update Date | 2025-03-25 00:45:31 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID02149605 |
---|
Frequency | 0.5 |
---|
Structure | |
---|
Chemical Formula | C7H7NO6S |
---|
Molecular Mass | 232.9994 |
---|
SMILES | O=C(O)c1cccnc1COS(=O)(=O)O |
---|
InChI Key | CFCCSGFJTDJAMQ-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organoheterocyclic compounds |
---|
Class | pyridines and derivatives |
---|
Subclass | pyridinecarboxylic acids and derivatives |
---|
Direct Parent | pyridine-3-carboxylic acids |
---|
Geometric Descriptor | aromatic heteromonocyclic compounds |
---|
Alternative Parents | 2-halopyridinesalkyl sulfatesazacyclic compoundscarboxylic acidsheteroaromatic compoundshydrocarbon derivativeshydroxypyridinesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundspolyhalopyridinessulfuric acid monoesters |
---|
Substituents | sulfuric acid monoestercarboxylic acidaromatic heteromonocyclic compoundpyridine-3-carboxylic acidpolyhalopyridinecarboxylic acid derivativeorganic oxidealkyl sulfateorganonitrogen compoundorganopnictogen compound2-halopyridineorganic sulfuric acid or derivativesazacycleheteroaromatic compoundhydroxypyridinemonocarboxylic acid or derivativesorganic oxygen compoundsulfate-esterhydrocarbon derivativeorganic nitrogen compoundsulfuric acid esterorganooxygen compound |
---|