| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:37:22 UTC |
|---|
| Update Date | 2025-03-25 00:45:31 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02149627 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H20N2O2 |
|---|
| Molecular Mass | 236.1525 |
|---|
| SMILES | CC(C)NCCC(O)c1cccc(C(N)=O)c1 |
|---|
| InChI Key | ZLPZTOWBKJWDDJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | benzamides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | amino acids and derivativesaromatic alcoholsbenzoyl derivativescarboxylic acids and derivativesdialkylamineshydrocarbon derivativesorganic oxidesorganopnictogen compoundsprimary carboxylic acid amidessecondary alcohols |
|---|
| Substituents | aromatic alcoholprimary carboxylic acid amidealcoholsecondary aliphatic amineamino acid or derivativesbenzoylsecondary aminecarboxamide groupcarboxylic acid derivativebenzamidearomatic homomonocyclic compoundorganic oxideorganic oxygen compoundorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganooxygen compoundamine |
|---|