| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:37:22 UTC |
|---|
| Update Date | 2025-03-25 00:45:31 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02149642 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H14O5 |
|---|
| Molecular Mass | 226.0841 |
|---|
| SMILES | O=C(CO)CC(O)Cc1cc(O)cc(O)c1 |
|---|
| InChI Key | RGCPDRLRDJSPMS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | fatty acyls |
|---|
| Subclass | fatty alcohols |
|---|
| Direct Parent | fatty alcohols |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsalpha-hydroxy ketonesbenzene and substituted derivativesbeta-hydroxy ketoneshydrocarbon derivativesorganic oxidesresorcinolssecondary alcohols |
|---|
| Substituents | alcoholbeta-hydroxy ketonemonocyclic benzene moietycarbonyl group1-hydroxy-2-unsubstituted benzenoid1-hydroxy-4-unsubstituted benzenoidalpha-hydroxy ketoneresorcinolketonearomatic homomonocyclic compoundorganic oxideorganic oxygen compoundfatty alcoholsecondary alcoholphenolhydrocarbon derivativebenzenoidorganooxygen compound |
|---|