| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:37:23 UTC |
|---|
| Update Date | 2025-03-25 00:45:32 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02149692 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H16O4 |
|---|
| Molecular Mass | 188.1049 |
|---|
| SMILES | CC1CC(C)C(C)(O)C(C(=O)O)O1 |
|---|
| InChI Key | SKBKKDXSWUJCSQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyrans |
|---|
| Subclass | pyran carboxylic acids and derivatives |
|---|
| Direct Parent | pyran carboxylic acids |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acidsdialkyl ethershydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesoxacyclic compoundsoxanestertiary alcohols |
|---|
| Substituents | alcoholcarbonyl groupethercarboxylic acidpyran carboxylic acid or derivativescarboxylic acid derivativedialkyl etheroxacycletertiary alcoholorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundaliphatic heteromonocyclic compoundhydrocarbon derivativeoxaneorganooxygen compound |
|---|
