| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:37:26 UTC |
|---|
| Update Date | 2025-03-25 00:45:33 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02149791 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H14O3 |
|---|
| Molecular Mass | 254.0943 |
|---|
| SMILES | O=C(CCO)c1cccc(C(=O)c2ccccc2)c1 |
|---|
| InChI Key | ZUNNQZMAJWDFFI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzophenones |
|---|
| Direct Parent | benzophenones |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alcohols and polyolsalkyl-phenylketonesaryl alkyl ketonesaryl-phenylketonesbenzoyl derivativesbeta-hydroxy ketonesdiphenylmethaneshydrocarbon derivativesorganic oxides |
|---|
| Substituents | alcoholdiphenylmethanebeta-hydroxy ketonearyl alkyl ketonearyl-phenylketonebenzoylphenylketonebenzophenoneketonearomatic homomonocyclic compoundorganic oxideorganic oxygen compoundhydrocarbon derivativealkyl-phenylketoneorganooxygen compoundaryl ketone |
|---|
