| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:37:28 UTC |
|---|
| Update Date | 2025-03-25 00:45:33 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02149883 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C23H25ClN2O2 |
|---|
| Molecular Mass | 396.1605 |
|---|
| SMILES | CCOC(=O)N1CCC(=C2c3ccc(Cl)cc3CCNc3ccccc32)CC1 |
|---|
| InChI Key | OVMKYFHBFOHKHQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | piperidines |
|---|
| Subclass | piperidinecarboxylic acids and derivatives |
|---|
| Direct Parent | piperidinecarboxylic acids |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | aryl chloridesazacyclic compoundsbenzenoidscarbamate esterscarbonyl compoundshydrocarbon derivativesorganic carbonic acids and derivativesorganic oxidesorganochloridesorganopnictogen compoundspiperidinessecondary alkylarylamines |
|---|
| Substituents | aryl chloridecarbonyl groupcarbonic acid derivativeazacycleorganochloridecarbamic acid estersecondary amineorganohalogen compoundsecondary aliphatic/aromatic aminearyl halideorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativepiperidinecarboxylic acidbenzenoidorganic nitrogen compoundamineorganooxygen compound |
|---|
