| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:37:34 UTC |
|---|
| Update Date | 2025-03-25 00:45:36 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02150136 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C23H28N4O3S2 |
|---|
| Molecular Mass | 472.1603 |
|---|
| SMILES | NC1CSCSCNC(=O)C(Cc2ccccc2)NC(=O)C(Cc2ccccc2)NC1=O |
|---|
| InChI Key | YRZWOIZBMYIWJL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic polymers |
|---|
| Class | polypeptides |
|---|
| Subclass | polypeptides |
|---|
| Direct Parent | polypeptides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | alpha amino acidsazacyclic compoundsbenzene and substituted derivativescarbonyl compoundscarboxylic acids and derivativescyclic peptidesdialkylthioethersdithioacetalshydrocarbon derivativeslactamsmacrolactamsmonoalkylaminesorganic oxidesorganonitrogen compoundsorganopnictogen compoundssecondary carboxylic acid amidesthiohemiaminal derivatives |
|---|
| Substituents | monocyclic benzene moietycarbonyl grouplactamaromatic heteromonocyclic compoundalpha-amino acid or derivativescarboxylic acid derivativemacrolactamorganic oxideorganonitrogen compoundalpha-amino acidhemithioaminalorganopnictogen compoundorganoheterocyclic compoundpolypeptideazacycledialkylthioethercarboxamide groupsecondary carboxylic acid amideorganic oxygen compoundcyclic alpha peptidethioetherhydrocarbon derivativebenzenoidprimary aliphatic aminethioacetalorganic nitrogen compoundorganooxygen compound |
|---|
