| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:37:37 UTC |
|---|
| Update Date | 2025-03-25 00:45:37 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02150255 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H13NO4 |
|---|
| Molecular Mass | 259.0845 |
|---|
| SMILES | COc1cc(O)ccc1NC(=O)c1ccccc1O |
|---|
| InChI Key | LTKFTUWBBHOJLU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | anilides |
|---|
| Direct Parent | benzanilides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsalkyl aryl ethersanisolesbenzamidesbenzoyl derivativescarboxylic acids and derivativeshydrocarbon derivativesmethoxybenzenesmethoxyphenolsorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphenoxy compoundssalicylamidessecondary carboxylic acid amidesvinylogous acids |
|---|
| Substituents | phenol etheretherbenzanilidemethoxyphenolbenzoyl1-hydroxy-2-unsubstituted benzenoidalkyl aryl ethercarboxylic acid derivativebenzamideorganic oxideorganonitrogen compoundorganopnictogen compoundbenzoic acid or derivatives1-hydroxy-4-unsubstituted benzenoidcarboxamide groupmethoxybenzenesalicylamidearomatic homomonocyclic compoundsecondary carboxylic acid amidevinylogous acidorganic oxygen compoundsalicylic acid or derivativesanisolephenolhydrocarbon derivativeorganic nitrogen compoundphenoxy compoundorganooxygen compound |
|---|
