| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:37:42 UTC |
|---|
| Update Date | 2025-03-25 00:45:39 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02150430 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H10O4 |
|---|
| Molecular Mass | 242.0579 |
|---|
| SMILES | Oc1ccc2c(ccc3c(O)c(O)cc(O)c32)c1 |
|---|
| InChI Key | UATLWYPXNJUWLF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenanthrenes and derivatives |
|---|
| Subclass | phenanthrols |
|---|
| Direct Parent | phenanthrols |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidshydrocarbon derivativeshydroquinonesnaphthols and derivativesorganooxygen compounds |
|---|
| Substituents | phenanthrol1-hydroxy-2-unsubstituted benzenoidaromatic homopolycyclic compoundhydroquinonenaphthaleneorganic oxygen compoundhydrocarbon derivative1-naphthol2-naphtholorganooxygen compound |
|---|