| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:37:47 UTC |
|---|
| Update Date | 2025-03-25 00:45:40 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02150620 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H26O5 |
|---|
| Molecular Mass | 310.178 |
|---|
| SMILES | CCC(CCC(C)O)COC(=O)c1ccc(OC)cc1OC |
|---|
| InChI Key | ZEVGNDGAKQMGJC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | o-methoxybenzoic acids and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersanisolesbenzoic acid estersbenzoyl derivativescarboxylic acid estersdimethoxybenzenesfatty alcoholshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesp-methoxybenzoic acids and derivativesphenoxy compoundssecondary alcohols |
|---|
| Substituents | fatty acylphenol etheretherbenzoylbenzoate esteralkyl aryl ethercarboxylic acid derivativedimethoxybenzeneorganic oxidefatty alcoholo-methoxybenzoic acid or derivativesalcoholmethoxybenzenearomatic homomonocyclic compoundmonocarboxylic acid or derivativesorganic oxygen compoundp-methoxybenzoic acid or derivativesm-dimethoxybenzeneanisolecarboxylic acid estersecondary alcoholhydrocarbon derivativephenoxy compoundorganooxygen compound |
|---|
