| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:37:49 UTC |
|---|
| Update Date | 2025-03-25 00:45:41 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02150701 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C20H18O10 |
|---|
| Molecular Mass | 418.09 |
|---|
| SMILES | O=c1c(-c2ccc(O)cc2)coc2cc(O)cc(OC3OC(O)C(O)C(O)C3O)c12 |
|---|
| InChI Key | MFYRBSGTZWZWJI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | isoflavonoids |
|---|
| Subclass | isoflavonoid o-glycosides |
|---|
| Direct Parent | isoflavonoid o-glycosides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsacetalsbenzene and substituted derivativeschromoneshemiacetalsheteroaromatic compoundshydrocarbon derivativesisoflavonesmonosaccharidesorganic oxidesoxacyclic compoundsoxanesphenol etherspyranones and derivativessecondary alcoholsvinylogous esters |
|---|
| Substituents | phenol ethermonocyclic benzene moiety1-benzopyran1-hydroxy-2-unsubstituted benzenoidmonosaccharidesaccharideorganic oxideacetalchromonearomatic heteropolycyclic compoundpyranonehemiacetaloxaneorganoheterocyclic compoundisoflavonealcoholbenzopyranvinylogous esterheteroaromatic compoundisoflavonoid o-glycosideoxacycleorganic oxygen compoundpyransecondary alcoholphenolhydrocarbon derivativebenzenoidisoflavonoid-5-o-glycosideorganooxygen compound |
|---|
